C25H30ClNO5 — CID 71078481
(2S,3R,4R,5S,6R)-2-[6-[[4-(azetidin-1-yl)phenyl]methyl]-7-chloro-2,3-dihydro-1H-inden-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71078481) has the molecular formula C25H30ClNO5 and a molecular weight of 459.97 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[6-[[4-(azetidin-1-yl)phenyl]methyl]-7-chloro-2,3-dihydro-1H-inden-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[6-[[4-(azetidin-1-yl)phenyl]methyl]-7-chloro-2,3-dihydro-1H-inden-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71078481 |
| Molecular Formula | C25H30ClNO5 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[6-[[4-(azetidin-1-yl)phenyl]methyl]-7-chloro-2,3-dihydro-1H-inden-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cc(Cc3ccc(N4CCC4)cc3)c(Cl)c3c2CCC3)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H30ClNO5/c26-21-15(11-14-5-7-16(8-6-14)27-9-2-10-27)12-19(17-3-1-4-18(17)21)25-24(31)23(30)22(29)20(13-28)32-25/h5-8,12,20,22-25,28-31H,1-4,9-11,13H2/t20-,22-,23+,24-,25+/m1/s1 |
| InChIKey | RDWVONQAUVYENN-HFBCXCLPSA-N |
| XLogP | 2.14 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|