C23H28O6S — CID 71078514
2-benzyl-2-(3,4-dihydro-2H-thiochromen-5-yl)-6-(hydroxymethyl)-3-methoxyoxane-3,4,5-triol (PubChem CID 71078514) has the molecular formula C23H28O6S and a molecular weight of 432.54 g/mol. Its IUPAC name is 2-benzyl-2-(3,4-dihydro-2H-thiochromen-5-yl)-6-(hydroxymethyl)-3-methoxyoxane-3,4,5-triol.
| Compound Name | 2-benzyl-2-(3,4-dihydro-2H-thiochromen-5-yl)-6-(hydroxymethyl)-3-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 71078514 |
| Molecular Formula | C23H28O6S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-benzyl-2-(3,4-dihydro-2H-thiochromen-5-yl)-6-(hydroxymethyl)-3-methoxyoxane-3,4,5-triol |
| SMILES | COC1(O)C(O)C(O)C(CO)OC1(Cc1ccccc1)c1cccc2c1CCCS2 |
| InChI | InChI=1S/C23H28O6S/c1-28-23(27)21(26)20(25)18(14-24)29-22(23,13-15-7-3-2-4-8-15)17-10-5-11-19-16(17)9-6-12-30-19/h2-5,7-8,10-11,18,20-21,24-27H,6,9,12-14H2,1H3 |
| InChIKey | BAPXJMGUWHURAA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|