C28H38B2N6O3 — CID 71078642
N-[[2-[9,10-dimethyl-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethylamino]-[[hydroxy(methyl)boranyl]amino]methylidene]-methylboronamidic acid (PubChem CID 71078642) has the molecular formula C28H38B2N6O3 and a molecular weight of 528.28 g/mol. Its IUPAC name is N-[[2-[9,10-dimethyl-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethylamino]-[[hydroxy(methyl)boranyl]amino]methylidene]-methylboronamidic acid.
| Compound Name | N-[[2-[9,10-dimethyl-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethylamino]-[[hydroxy(methyl)boranyl]amino]methylidene]-methylboronamidic acid |
|---|---|
| PubChem CID | 71078642 |
| Molecular Formula | C28H38B2N6O3 |
| Molecular Weight | 528.28 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | N-[[2-[9,10-dimethyl-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethylamino]-[[hydroxy(methyl)boranyl]amino]methylidene]-methylboronamidic acid |
| SMILES | CB(O)N=C(NCCn1c(=O)n2c(c/c1=N\c1c(C)cc(C)cc1C)-c1cc(C)c(C)cc1CC2)NB(C)O |
| InChI | InChI=1S/C28H38B2N6O3/c1-17-12-20(4)26(21(5)13-17)32-25-16-24-23-15-19(3)18(2)14-22(23)8-10-35(24)28(37)36(25)11-9-31-27(33-29(6)38)34-30(7)39/h12-16,38-39H,8-11H2,1-7H3,(H2,31,33,34)/b32-25+ |
| InChIKey | WXPIHWBOVINTAB-WGPBWIAQSA-N |
| XLogP | 2.40 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|