C32H35N5O2 — CID 71078643
1-[2-[9,10-dimethyl-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethyl]-3-phenylurea (PubChem CID 71078643) has the molecular formula C32H35N5O2 and a molecular weight of 521.67 g/mol. Its IUPAC name is 1-[2-[9,10-dimethyl-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethyl]-3-phenylurea.
| Compound Name | 1-[2-[9,10-dimethyl-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 71078643 |
| Molecular Formula | C32H35N5O2 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 1-[2-[9,10-dimethyl-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethyl]-3-phenylurea |
| SMILES | Cc1cc(C)c(/N=c2\cc3n(c(=O)n2CCNC(=O)Nc2ccccc2)CCc2cc(C)c(C)cc2-3)c(C)c1 |
| InChI | InChI=1S/C32H35N5O2/c1-20-15-23(4)30(24(5)16-20)35-29-19-28-27-18-22(3)21(2)17-25(27)11-13-36(28)32(39)37(29)14-12-33-31(38)34-26-9-7-6-8-10-26/h6-10,15-19H,11-14H2,1-5H3,(H2,33,34,38)/b35-29+ |
| InChIKey | CBPOGNPNEQESJI-OZMGXUMRSA-N |
| XLogP | 5.47 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |