C28H35N5O2 — CID 71078651
4-[9,10-dimethyl-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]butylurea (PubChem CID 71078651) has the molecular formula C28H35N5O2 and a molecular weight of 473.62 g/mol. Its IUPAC name is 4-[9,10-dimethyl-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]butylurea.
| Compound Name | 4-[9,10-dimethyl-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]butylurea |
|---|---|
| PubChem CID | 71078651 |
| Molecular Formula | C28H35N5O2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | 4-[9,10-dimethyl-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]butylurea |
| SMILES | Cc1cc(C)c(/N=c2\cc3n(c(=O)n2CCCCNC(N)=O)CCc2cc(C)c(C)cc2-3)c(C)c1 |
| InChI | InChI=1S/C28H35N5O2/c1-17-12-20(4)26(21(5)13-17)31-25-16-24-23-15-19(3)18(2)14-22(23)8-11-32(24)28(35)33(25)10-7-6-9-30-27(29)34/h12-16H,6-11H2,1-5H3,(H3,29,30,34)/b31-25+ |
| InChIKey | XMLIHWOHDJSPCD-QCKNELIISA-N |
| XLogP | 4.10 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|