C22H37N3O3Si2 — CID 71078798
1-butyl-3-[3-[dimethyl-(4-trimethylsilylphenyl)silyl]propyl]-5-methyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 71078798) has the molecular formula C22H37N3O3Si2 and a molecular weight of 447.73 g/mol. Its IUPAC name is 1-butyl-3-[3-[dimethyl-(4-trimethylsilylphenyl)silyl]propyl]-5-methyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-butyl-3-[3-[dimethyl-(4-trimethylsilylphenyl)silyl]propyl]-5-methyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 71078798 |
| Molecular Formula | C22H37N3O3Si2 |
| Molecular Weight | 447.73 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 1-butyl-3-[3-[dimethyl-(4-trimethylsilylphenyl)silyl]propyl]-5-methyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCCn1c(=O)n(C)c(=O)n(CCC[Si](C)(C)c2ccc([Si](C)(C)C)cc2)c1=O |
| InChI | InChI=1S/C22H37N3O3Si2/c1-8-9-15-24-20(26)23(2)21(27)25(22(24)28)16-10-17-30(6,7)19-13-11-18(12-14-19)29(3,4)5/h11-14H,8-10,15-17H2,1-7H3 |
| InChIKey | KQUXYXALGJSGJF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.73 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|