About [4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate
[4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate (PubChem CID 71079165) has the molecular formula C21H29NO5
and a molecular weight of 375.47 g/mol. Its IUPAC name is [4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate |
| PubChem CID | 71079165 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | [4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1=C(c2cc(C)ccc2C)OCNC12CCC(OC)CC2 |
| InChI | InChI=1S/C21H29NO5/c1-5-25-20(23)27-19-18(17-12-14(2)6-7-15(17)3)26-13-22-21(19)10-8-16(24-4)9-11-21/h6-7,12,16,22H,5,8-11,13H2,1-4H3 |
| InChIKey | UHMDJGHUWUBBFJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate?
The IUPAC name of [4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate (CID 71079165) is [4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate.
What is the SMILES notation for [4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate?
The canonical SMILES for [4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate is CCOC(=O)OC1=C(c2cc(C)ccc2C)OCNC12CCC(OC)CC2.
What is the InChIKey of [4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate?
The InChIKey is UHMDJGHUWUBBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO5/c1-5-25-20(23)27-19-18(17-12-14(2)6-7-15(17)3)26-13-22-21(19)10-8-16(24-4)9-11-21/h6-7,12,16,22H,5,8-11,13H2,1-4H3.
What are the key properties of [4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate?
[4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate has a molecular weight of 375.47 g/mol, XLogP of 4.05, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,5-dimethylphenyl)-9-methoxy-3-oxa-1-azaspiro[5.5]undec-4-en-5-yl] ethyl carbonate is sourced from PubChem (CID 71079165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).