About 7-bromo-5H-pyrido[4,3-b]indole
7-bromo-5H-pyrido[4,3-b]indole (PubChem CID 71079324) has the molecular formula C11H7BrN2
and a molecular weight of 247.10 g/mol. Its IUPAC name is 7-bromo-5H-pyrido[4,3-b]indole.
Molecular Properties
| Compound Name | 7-bromo-5H-pyrido[4,3-b]indole |
| PubChem CID | 71079324 |
| Molecular Formula | C11H7BrN2 |
| Molecular Weight | 247.10 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 7-bromo-5H-pyrido[4,3-b]indole |
| SMILES | Brc1ccc2c(c1)[nH]c1ccncc12 |
| InChI | InChI=1S/C11H7BrN2/c12-7-1-2-8-9-6-13-4-3-10(9)14-11(8)5-7/h1-6,14H |
| InChIKey | JYFKMOCKASWCPZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.10 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-5H-pyrido[4,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5H-pyrido[4,3-b]indole?
The IUPAC name of 7-bromo-5H-pyrido[4,3-b]indole (CID 71079324) is 7-bromo-5H-pyrido[4,3-b]indole.
What is the SMILES notation for 7-bromo-5H-pyrido[4,3-b]indole?
The canonical SMILES for 7-bromo-5H-pyrido[4,3-b]indole is Brc1ccc2c(c1)[nH]c1ccncc12.
What is the InChIKey of 7-bromo-5H-pyrido[4,3-b]indole?
The InChIKey is JYFKMOCKASWCPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrN2/c12-7-1-2-8-9-6-13-4-3-10(9)14-11(8)5-7/h1-6,14H.
What are the key properties of 7-bromo-5H-pyrido[4,3-b]indole?
7-bromo-5H-pyrido[4,3-b]indole has a molecular weight of 247.10 g/mol, XLogP of 3.48, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5H-pyrido[4,3-b]indole is sourced from PubChem (CID 71079324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).