C27H28FN3O — CID 71079782
(3E,6S,9aR)-6-(2-fluorophenyl)-3-[[3-methyl-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one (PubChem CID 71079782) has the molecular formula C27H28FN3O and a molecular weight of 429.54 g/mol. Its IUPAC name is (3E,6S,9aR)-6-(2-fluorophenyl)-3-[[3-methyl-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one.
| Compound Name | (3E,6S,9aR)-6-(2-fluorophenyl)-3-[[3-methyl-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one |
|---|---|
| PubChem CID | 71079782 |
| Molecular Formula | C27H28FN3O |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (3E,6S,9aR)-6-(2-fluorophenyl)-3-[[3-methyl-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one |
| SMILES | Cc1cn(-c2ccc(/C=C3\CC[C@H]4CCC[C@@H](c5ccccc5F)N4C3=O)cc2C)cn1 |
| InChI | InChI=1S/C27H28FN3O/c1-18-14-20(10-13-25(18)30-16-19(2)29-17-30)15-21-11-12-22-6-5-9-26(31(22)27(21)32)23-7-3-4-8-24(23)28/h3-4,7-8,10,13-17,22,26H,5-6,9,11-12H2,1-2H3/b21-15+/t22-,26+/m1/s1 |
| InChIKey | QAVNPIZDTYGALJ-CXIMASHISA-N |
| XLogP | 5.93 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|