C25H31NO3 — CID 71079784
(8R,13S,17S)-3-methoxy-13-methyl-17-(oxan-2-yloxy)-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-8-carbonitrile (PubChem CID 71079784) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is (8R,13S,17S)-3-methoxy-13-methyl-17-(oxan-2-yloxy)-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-8-carbonitrile.
| Compound Name | (8R,13S,17S)-3-methoxy-13-methyl-17-(oxan-2-yloxy)-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-8-carbonitrile |
|---|---|
| PubChem CID | 71079784 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (8R,13S,17S)-3-methoxy-13-methyl-17-(oxan-2-yloxy)-7,12,14,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-8-carbonitrile |
| SMILES | COc1ccc2c(c1)CC[C@]1(C#N)C2=CC[C@@]2(C)C1CC[C@@H]2OC1CCCCO1 |
| InChI | InChI=1S/C25H31NO3/c1-24-12-11-20-19-7-6-18(27-2)15-17(19)10-13-25(20,16-26)21(24)8-9-22(24)29-23-5-3-4-14-28-23/h6-7,11,15,21-23H,3-5,8-10,12-14H2,1-2H3/t21?,22-,23?,24-,25-/m0/s1 |
| InChIKey | QHFOURHUEOOILT-RNJLCNHASA-N |
| XLogP | 5.27 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |