About (2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine
(2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine (PubChem CID 71079932) has the molecular formula C10H10F2IN
and a molecular weight of 309.10 g/mol. Its IUPAC name is (2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine.
Molecular Properties
| Compound Name | (2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine |
| PubChem CID | 71079932 |
| Molecular Formula | C10H10F2IN |
| Molecular Weight | 309.10 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | (2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine |
| SMILES | C/C=c1/cc(I)cn/c1=C(\F)C(C)F |
| InChI | InChI=1S/C10H10F2IN/c1-3-7-4-8(13)5-14-10(7)9(12)6(2)11/h3-6H,1-2H3/b7-3-,10-9- |
| InChIKey | LVDOPLNGCREBIA-ZBRHRFEQSA-N |
| XLogP | 1.92 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.10 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine?
The IUPAC name of (2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine (CID 71079932) is (2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine.
What is the SMILES notation for (2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine?
The canonical SMILES for (2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine is C/C=c1/cc(I)cn/c1=C(\F)C(C)F.
What is the InChIKey of (2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine?
The InChIKey is LVDOPLNGCREBIA-ZBRHRFEQSA-N. The full InChI is InChI=1S/C10H10F2IN/c1-3-7-4-8(13)5-14-10(7)9(12)6(2)11/h3-6H,1-2H3/b7-3-,10-9-.
What are the key properties of (2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine?
(2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine has a molecular weight of 309.10 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,3Z)-2-(1,2-difluoropropylidene)-3-ethylidene-5-iodopyridine is sourced from PubChem (CID 71079932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).