About (4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one
(4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one (PubChem CID 71079939) has the molecular formula C19H34O4
and a molecular weight of 326.48 g/mol. Its IUPAC name is (4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one |
| PubChem CID | 71079939 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one |
| SMILES | CCCCOCC1=CC(=O)C[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C19H34O4/c1-4-7-10-21-15-16-13-17(20)14-18(22-11-8-5-2)19(16)23-12-9-6-3/h13,18-19H,4-12,14-15H2,1-3H3/t18-,19-/m1/s1 |
| InChIKey | SYMHBHRAIAMWBQ-RTBURBONSA-N |
| XLogP | 4.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one?
The IUPAC name of (4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one (CID 71079939) is (4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one.
What is the SMILES notation for (4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one?
The canonical SMILES for (4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one is CCCCOCC1=CC(=O)C[C@@H](OCCCC)[C@@H]1OCCCC.
What is the InChIKey of (4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one?
The InChIKey is SYMHBHRAIAMWBQ-RTBURBONSA-N. The full InChI is InChI=1S/C19H34O4/c1-4-7-10-21-15-16-13-17(20)14-18(22-11-8-5-2)19(16)23-12-9-6-3/h13,18-19H,4-12,14-15H2,1-3H3/t18-,19-/m1/s1.
What are the key properties of (4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one?
(4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one has a molecular weight of 326.48 g/mol, XLogP of 4.07, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-4,5-dibutoxy-3-(butoxymethyl)cyclohex-2-en-1-one is sourced from PubChem (CID 71079939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).