C29H58O5Si — CID 71079950
hydroxy-dimethyl-[2-methyl-1-[(1R,4R,5R,6S)-4,5,6-tributoxy-3-(butoxymethyl)cyclohex-2-en-1-yl]propan-2-yl]silane (PubChem CID 71079950) has the molecular formula C29H58O5Si and a molecular weight of 514.86 g/mol. Its IUPAC name is hydroxy-dimethyl-[2-methyl-1-[(1R,4R,5R,6S)-4,5,6-tributoxy-3-(butoxymethyl)cyclohex-2-en-1-yl]propan-2-yl]silane.
| Compound Name | hydroxy-dimethyl-[2-methyl-1-[(1R,4R,5R,6S)-4,5,6-tributoxy-3-(butoxymethyl)cyclohex-2-en-1-yl]propan-2-yl]silane |
|---|---|
| PubChem CID | 71079950 |
| Molecular Formula | C29H58O5Si |
| Molecular Weight | 514.86 g/mol |
| Exact Mass | 514.41 |
| IUPAC Name | hydroxy-dimethyl-[2-methyl-1-[(1R,4R,5R,6S)-4,5,6-tributoxy-3-(butoxymethyl)cyclohex-2-en-1-yl]propan-2-yl]silane |
| SMILES | CCCCOCC1=C[C@@H](CC(C)(C)[Si](C)(C)O)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C29H58O5Si/c1-9-13-17-31-23-25-21-24(22-29(5,6)35(7,8)30)26(32-18-14-10-2)28(34-20-16-12-4)27(25)33-19-15-11-3/h21,24,26-28,30H,9-20,22-23H2,1-8H3/t24-,26-,27+,28+/m0/s1 |
| InChIKey | IJDWJOCSXSCDCQ-GDWZEYGFSA-N |
| XLogP | 7.28 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.86 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|