C13H16F2O6 — CID 71079964
(1R,2S,3R,4R,6S)-5,5-difluoro-4-(hydroxymethyl)-6-(4-hydroxyphenoxy)cyclohexane-1,2,3-triol (PubChem CID 71079964) has the molecular formula C13H16F2O6 and a molecular weight of 306.26 g/mol. Its IUPAC name is (1R,2S,3R,4R,6S)-5,5-difluoro-4-(hydroxymethyl)-6-(4-hydroxyphenoxy)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2S,3R,4R,6S)-5,5-difluoro-4-(hydroxymethyl)-6-(4-hydroxyphenoxy)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 71079964 |
| Molecular Formula | C13H16F2O6 |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (1R,2S,3R,4R,6S)-5,5-difluoro-4-(hydroxymethyl)-6-(4-hydroxyphenoxy)cyclohexane-1,2,3-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)C(O)[C@H](Oc2ccc(O)cc2)C1(F)F |
| InChI | InChI=1S/C13H16F2O6/c14-13(15)8(5-16)9(18)10(19)11(20)12(13)21-7-3-1-6(17)2-4-7/h1-4,8-12,16-20H,5H2/t8-,9-,10+,11?,12+/m1/s1 |
| InChIKey | PIRSYSBZACJVMC-ARHMULMVSA-N |
| XLogP | -0.52 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |