C41H57FO5S — CID 71079980
(2R,3R,4R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]cyclohexan-1-one (PubChem CID 71079980) has the molecular formula C41H57FO5S and a molecular weight of 680.97 g/mol. Its IUPAC name is (2R,3R,4R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]cyclohexan-1-one.
| Compound Name | (2R,3R,4R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 71079980 |
| Molecular Formula | C41H57FO5S |
| Molecular Weight | 680.97 g/mol |
| Exact Mass | 680.39 |
| IUPAC Name | (2R,3R,4R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]cyclohexan-1-one |
| SMILES | CCCCOC[C@H]1C(=O)C(c2ccc(C)c(Cc3ccc(-c4ccc(F)cc4)s3)c2)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C41H57FO5S/c1-6-10-22-44-28-35-38(43)37(40(46-24-12-8-3)41(47-25-13-9-4)39(35)45-23-11-7-2)31-15-14-29(5)32(26-31)27-34-20-21-36(48-34)30-16-18-33(42)19-17-30/h14-21,26,35,37,39-41H,6-13,22-25,27-28H2,1-5H3/t35-,37?,39+,40-,41-/m0/s1 |
| InChIKey | GVGXYSNTUKQTCN-QSUHLQPMSA-N |
| XLogP | 10.11 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.97 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|