C23H44O6 — CID 71080001
(2R,3S,4S)-2,3,4-tributoxy-5-(butoxymethyl)-5-hydroxycyclohexan-1-one (PubChem CID 71080001) has the molecular formula C23H44O6 and a molecular weight of 416.60 g/mol. Its IUPAC name is (2R,3S,4S)-2,3,4-tributoxy-5-(butoxymethyl)-5-hydroxycyclohexan-1-one.
| Compound Name | (2R,3S,4S)-2,3,4-tributoxy-5-(butoxymethyl)-5-hydroxycyclohexan-1-one |
|---|---|
| PubChem CID | 71080001 |
| Molecular Formula | C23H44O6 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | (2R,3S,4S)-2,3,4-tributoxy-5-(butoxymethyl)-5-hydroxycyclohexan-1-one |
| SMILES | CCCCOCC1(O)CC(=O)[C@H](OCCCC)C(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C23H44O6/c1-5-9-13-26-18-23(25)17-19(24)20(27-14-10-6-2)21(28-15-11-7-3)22(23)29-16-12-8-4/h20-22,25H,5-18H2,1-4H3/t20-,21?,22-,23?/m0/s1 |
| InChIKey | YYUPCNUQTMFYKM-ZDDBVQPTSA-N |
| XLogP | 4.06 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|