C25H46O7 — CID 71080012
[(1S,2R,3S,4R,5R)-2,3,4-tributoxy-5-(butoxymethyl)-6-oxocyclohexyl] acetate (PubChem CID 71080012) has the molecular formula C25H46O7 and a molecular weight of 458.64 g/mol. Its IUPAC name is [(1S,2R,3S,4R,5R)-2,3,4-tributoxy-5-(butoxymethyl)-6-oxocyclohexyl] acetate.
| Compound Name | [(1S,2R,3S,4R,5R)-2,3,4-tributoxy-5-(butoxymethyl)-6-oxocyclohexyl] acetate |
|---|---|
| PubChem CID | 71080012 |
| Molecular Formula | C25H46O7 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | [(1S,2R,3S,4R,5R)-2,3,4-tributoxy-5-(butoxymethyl)-6-oxocyclohexyl] acetate |
| SMILES | CCCCOC[C@H]1C(=O)C(OC(C)=O)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C25H46O7/c1-6-10-14-28-18-20-21(27)23(32-19(5)26)25(31-17-13-9-4)24(30-16-12-8-3)22(20)29-15-11-7-2/h20,22-25H,6-18H2,1-5H3/t20-,22+,23?,24-,25-/m0/s1 |
| InChIKey | XTSRRFSJUAXXJE-VRCBSPKVSA-N |
| XLogP | 4.49 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|