C15H13NO5 — CID 7108015
(10S)-10-(hydroxyiminomethyl)-8,8-dimethyl-10H-pyrano[2,3-f]chromene-2,9-dione (PubChem CID 7108015) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is (10S)-10-(hydroxyiminomethyl)-8,8-dimethyl-10H-pyrano[2,3-f]chromene-2,9-dione.
| Compound Name | (10S)-10-(hydroxyiminomethyl)-8,8-dimethyl-10H-pyrano[2,3-f]chromene-2,9-dione |
|---|---|
| PubChem CID | 7108015 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (10S)-10-(hydroxyiminomethyl)-8,8-dimethyl-10H-pyrano[2,3-f]chromene-2,9-dione |
| SMILES | CC1(C)Oc2ccc3ccc(=O)oc3c2[C@@H](C=NO)C1=O |
| InChI | InChI=1S/C15H13NO5/c1-15(2)14(18)9(7-16-19)12-10(21-15)5-3-8-4-6-11(17)20-13(8)12/h3-7,9,19H,1-2H3/t9-/m1/s1 |
| InChIKey | KLYUTOYMOGYVCW-SECBINFHSA-N |
| XLogP | 2.08 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|