About [[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol
[[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol (PubChem CID 71080618) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is [[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol.
Molecular Properties
| Compound Name | [[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol |
| PubChem CID | 71080618 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | [[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol |
| SMILES | CC1=CC(N2CC(C)OC(C)C2)CCC1NCO |
| InChI | InChI=1S/C14H26N2O2/c1-10-6-13(4-5-14(10)15-9-17)16-7-11(2)18-12(3)8-16/h6,11-15,17H,4-5,7-9H2,1-3H3 |
| InChIKey | YHQDIHQHLCUIPD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol?
The IUPAC name of [[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol (CID 71080618) is [[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol.
What is the SMILES notation for [[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol?
The canonical SMILES for [[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol is CC1=CC(N2CC(C)OC(C)C2)CCC1NCO.
What is the InChIKey of [[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol?
The InChIKey is YHQDIHQHLCUIPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2/c1-10-6-13(4-5-14(10)15-9-17)16-7-11(2)18-12(3)8-16/h6,11-15,17H,4-5,7-9H2,1-3H3.
What are the key properties of [[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol?
[[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol has a molecular weight of 254.37 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[4-(2,6-dimethylmorpholin-4-yl)-2-methylcyclohex-2-en-1-yl]amino]methanol is sourced from PubChem (CID 71080618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).