C14H29FN2O2 — CID 71080624
1-[[(4S)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-fluoropentyl]amino]propan-1-ol (PubChem CID 71080624) has the molecular formula C14H29FN2O2 and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-[[(4S)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-fluoropentyl]amino]propan-1-ol.
| Compound Name | 1-[[(4S)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-fluoropentyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 71080624 |
| Molecular Formula | C14H29FN2O2 |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1-[[(4S)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-fluoropentyl]amino]propan-1-ol |
| SMILES | CCC(O)NCCC[C@@H](CF)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C14H29FN2O2/c1-4-14(18)16-7-5-6-13(8-15)17-9-11(2)19-12(3)10-17/h11-14,16,18H,4-10H2,1-3H3/t11-,12+,13-,14?/m0/s1 |
| InChIKey | IFHVKRICZOCIKC-WJLOJVBCSA-N |
| XLogP | 1.53 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|