C23H33FN4O4 — CID 71080761
2-fluoro-N-(3-hydroxypropyl)-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzamide (PubChem CID 71080761) has the molecular formula C23H33FN4O4 and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-fluoro-N-(3-hydroxypropyl)-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzamide.
| Compound Name | 2-fluoro-N-(3-hydroxypropyl)-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 71080761 |
| Molecular Formula | C23H33FN4O4 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-fluoro-N-(3-hydroxypropyl)-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzamide |
| SMILES | CC(C)c1noc(N2CCC(CCCOc3ccc(C(=O)NCCCO)c(F)c3)CC2)n1 |
| InChI | InChI=1S/C23H33FN4O4/c1-16(2)21-26-23(32-27-21)28-11-8-17(9-12-28)5-3-14-31-18-6-7-19(20(24)15-18)22(30)25-10-4-13-29/h6-7,15-17,29H,3-5,8-14H2,1-2H3,(H,25,30) |
| InChIKey | QVUQGGHXLAGUHE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|