About 2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole
2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole (PubChem CID 71080847) has the molecular formula C23H26S2
and a molecular weight of 366.60 g/mol. Its IUPAC name is 2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole.
Molecular Properties
| Compound Name | 2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole |
| PubChem CID | 71080847 |
| Molecular Formula | C23H26S2 |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole |
| SMILES | CCC(C)c1cc2cc3cc4sc(C(C)(C)CC)cc4cc3cc2s1 |
| InChI | InChI=1S/C23H26S2/c1-6-14(3)19-12-17-8-15-11-21-18(9-16(15)10-20(17)24-19)13-22(25-21)23(4,5)7-2/h8-14H,6-7H2,1-5H3 |
| InChIKey | AQCQGPIXSZRGFI-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole?
The IUPAC name of 2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole (CID 71080847) is 2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole.
What is the SMILES notation for 2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole?
The canonical SMILES for 2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole is CCC(C)c1cc2cc3cc4sc(C(C)(C)CC)cc4cc3cc2s1.
What is the InChIKey of 2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole?
The InChIKey is AQCQGPIXSZRGFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26S2/c1-6-14(3)19-12-17-8-15-11-21-18(9-16(15)10-20(17)24-19)13-22(25-21)23(4,5)7-2/h8-14H,6-7H2,1-5H3.
What are the key properties of 2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole?
2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole has a molecular weight of 366.60 g/mol, XLogP of 8.47, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-7-(2-methylbutan-2-yl)-[1]benzothiolo[6,5-f][1]benzothiole is sourced from PubChem (CID 71080847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).