About N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide
N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide (PubChem CID 71080916) has the molecular formula C13H14BrF2NOS
and a molecular weight of 350.23 g/mol. Its IUPAC name is N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide.
Molecular Properties
| Compound Name | N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide |
| PubChem CID | 71080916 |
| Molecular Formula | C13H14BrF2NOS |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide |
| SMILES | CC(C)S(=O)N=C1CCC(F)(F)c2ccc(Br)cc21 |
| InChI | InChI=1S/C13H14BrF2NOS/c1-8(2)19(18)17-12-5-6-13(15,16)11-4-3-9(14)7-10(11)12/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | IALVAFLPVMZPHX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide?
The IUPAC name of N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide (CID 71080916) is N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide.
What is the SMILES notation for N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide?
The canonical SMILES for N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide is CC(C)S(=O)N=C1CCC(F)(F)c2ccc(Br)cc21.
What is the InChIKey of N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide?
The InChIKey is IALVAFLPVMZPHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrF2NOS/c1-8(2)19(18)17-12-5-6-13(15,16)11-4-3-9(14)7-10(11)12/h3-4,7-8H,5-6H2,1-2H3.
What are the key properties of N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide?
N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide has a molecular weight of 350.23 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-ylidene)propane-2-sulfinamide is sourced from PubChem (CID 71080916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).