C26H24ClFN2O — CID 71081277
5-(5-chloro-2-methoxyphenyl)-2-(5-fluoro-2-methylphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraene (PubChem CID 71081277) has the molecular formula C26H24ClFN2O and a molecular weight of 434.94 g/mol. Its IUPAC name is 5-(5-chloro-2-methoxyphenyl)-2-(5-fluoro-2-methylphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraene.
| Compound Name | 5-(5-chloro-2-methoxyphenyl)-2-(5-fluoro-2-methylphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 71081277 |
| Molecular Formula | C26H24ClFN2O |
| Molecular Weight | 434.94 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 5-(5-chloro-2-methoxyphenyl)-2-(5-fluoro-2-methylphenyl)-10,10-dimethyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraene |
| SMILES | COc1ccc(Cl)cc1-c1ccc2c3c1CN(c1cc(F)ccc1C)C3=CC(C)(C)N2 |
| InChI | InChI=1S/C26H24ClFN2O/c1-15-5-7-17(28)12-22(15)30-14-20-18(19-11-16(27)6-10-24(19)31-4)8-9-21-25(20)23(30)13-26(2,3)29-21/h5-13,29H,14H2,1-4H3 |
| InChIKey | YRUWESYYAVXWHO-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.94 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |