C22H34O4 — CID 71081324
[4-methyl-5-oxo-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]oxolan-3-yl] acetate (PubChem CID 71081324) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [4-methyl-5-oxo-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]oxolan-3-yl] acetate.
| Compound Name | [4-methyl-5-oxo-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 71081324 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [4-methyl-5-oxo-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)OC(=O)C1C |
| InChI | InChI=1S/C22H34O4/c1-15(2)9-7-10-16(3)11-8-12-17(4)13-14-20-21(25-19(6)23)18(5)22(24)26-20/h9,11,13,18,20-21H,7-8,10,12,14H2,1-6H3/b16-11+,17-13+ |
| InChIKey | FXCLOLKYXXJCBE-IUBLYSDUSA-N |
| XLogP | 5.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|