C8H13FIN — CID 71081824
(3aR,6aS)-6a-fluoro-3a-iodo-2-methyl-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole (PubChem CID 71081824) has the molecular formula C8H13FIN and a molecular weight of 269.10 g/mol. Its IUPAC name is (3aR,6aS)-6a-fluoro-3a-iodo-2-methyl-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aR,6aS)-6a-fluoro-3a-iodo-2-methyl-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 71081824 |
| Molecular Formula | C8H13FIN |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | (3aR,6aS)-6a-fluoro-3a-iodo-2-methyl-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole |
| SMILES | CN1C[C@@]2(F)CCC[C@@]2(I)C1 |
| InChI | InChI=1S/C8H13FIN/c1-11-5-7(9)3-2-4-8(7,10)6-11/h2-6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | RMJSRKOVRVVEEM-JGVFFNPUSA-N |
| XLogP | 2.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|