C7H10F2IN — CID 71081870
(3aS,6aS)-6,6-difluoro-3a-iodo-1,2,3,4,5,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 71081870) has the molecular formula C7H10F2IN and a molecular weight of 273.06 g/mol. Its IUPAC name is (3aS,6aS)-6,6-difluoro-3a-iodo-1,2,3,4,5,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | (3aS,6aS)-6,6-difluoro-3a-iodo-1,2,3,4,5,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 71081870 |
| Molecular Formula | C7H10F2IN |
| Molecular Weight | 273.06 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | (3aS,6aS)-6,6-difluoro-3a-iodo-1,2,3,4,5,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | FC1(F)CC[C@@]2(I)CNC[C@@H]12 |
| InChI | InChI=1S/C7H10F2IN/c8-7(9)2-1-6(10)4-11-3-5(6)7/h5,11H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | YSPQUOAOKRKERU-PHDIDXHHSA-N |
| XLogP | 1.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.06 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|