C24H38O6 — CID 71081970
(2S,3R,6R,8R,10R)-3-[(2R)-3-ethyl-2,4-dimethyl-5-oxooxolan-2-yl]-2,6,8,10,12-pentamethyl-4,13-dioxabicyclo[8.2.1]tridecane-5,7-dione (PubChem CID 71081970) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is (2S,3R,6R,8R,10R)-3-[(2R)-3-ethyl-2,4-dimethyl-5-oxooxolan-2-yl]-2,6,8,10,12-pentamethyl-4,13-dioxabicyclo[8.2.1]tridecane-5,7-dione.
| Compound Name | (2S,3R,6R,8R,10R)-3-[(2R)-3-ethyl-2,4-dimethyl-5-oxooxolan-2-yl]-2,6,8,10,12-pentamethyl-4,13-dioxabicyclo[8.2.1]tridecane-5,7-dione |
|---|---|
| PubChem CID | 71081970 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (2S,3R,6R,8R,10R)-3-[(2R)-3-ethyl-2,4-dimethyl-5-oxooxolan-2-yl]-2,6,8,10,12-pentamethyl-4,13-dioxabicyclo[8.2.1]tridecane-5,7-dione |
| SMILES | CCC1C(C)C(=O)O[C@@]1(C)[C@@H]1OC(=O)[C@H](C)C(=O)[C@H](C)C[C@@]2(C)CC(C)C(O2)[C@@H]1C |
| InChI | InChI=1S/C24H38O6/c1-9-17-14(4)22(27)30-24(17,8)20-16(6)19-13(3)11-23(7,29-19)10-12(2)18(25)15(5)21(26)28-20/h12-17,19-20H,9-11H2,1-8H3/t12-,13?,14?,15-,16+,17?,19?,20-,23+,24-/m1/s1 |
| InChIKey | FJWCDSRYPIMFGG-CCBGJIHUSA-N |
| XLogP | 3.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|