C19H30O2 — CID 71082019
4'b,8',8'-trimethylspiro[1,3-dioxolane-2,7'-2,3,5,6,8a,9,10,10a-octahydro-1H-phenanthrene] (PubChem CID 71082019) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 4'b,8',8'-trimethylspiro[1,3-dioxolane-2,7'-2,3,5,6,8a,9,10,10a-octahydro-1H-phenanthrene].
| Compound Name | 4'b,8',8'-trimethylspiro[1,3-dioxolane-2,7'-2,3,5,6,8a,9,10,10a-octahydro-1H-phenanthrene] |
|---|---|
| PubChem CID | 71082019 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 4'b,8',8'-trimethylspiro[1,3-dioxolane-2,7'-2,3,5,6,8a,9,10,10a-octahydro-1H-phenanthrene] |
| SMILES | CC12CCC3(OCCO3)C(C)(C)C1CCC1CCCC=C12 |
| InChI | InChI=1S/C19H30O2/c1-17(2)16-9-8-14-6-4-5-7-15(14)18(16,3)10-11-19(17)20-12-13-21-19/h7,14,16H,4-6,8-13H2,1-3H3 |
| InChIKey | YKOULACFUQEMLN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|