C13H18N2S — CID 71082101
4-[(1R)-1-(5,6-dimethylcyclohexa-2,4-dien-1-yl)ethyl]-1,3-dihydroimidazole-2-thione (PubChem CID 71082101) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 4-[(1R)-1-(5,6-dimethylcyclohexa-2,4-dien-1-yl)ethyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[(1R)-1-(5,6-dimethylcyclohexa-2,4-dien-1-yl)ethyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 71082101 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 4-[(1R)-1-(5,6-dimethylcyclohexa-2,4-dien-1-yl)ethyl]-1,3-dihydroimidazole-2-thione |
| SMILES | CC1=CC=CC([C@@H](C)c2c[nH]c(=S)[nH]2)C1C |
| InChI | InChI=1S/C13H18N2S/c1-8-5-4-6-11(9(8)2)10(3)12-7-14-13(16)15-12/h4-7,9-11H,1-3H3,(H2,14,15,16)/t9?,10-,11?/m1/s1 |
| InChIKey | UCAYYVKALOCCSC-HSOILSAZSA-N |
| XLogP | 3.94 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|