C32H44N4O4S — CID 71082130
(17R)-28-heptyl-13,16-dimethyl-9,9-dioxo-19-oxa-9λ6-thia-1,8,13,16-tetrazapentacyclo[15.9.1.12,6.13,26.020,25]nonacosa-2,4,6(29),20,22,24,26(28)-heptaen-7-one (PubChem CID 71082130) has the molecular formula C32H44N4O4S and a molecular weight of 580.80 g/mol. Its IUPAC name is (17R)-28-heptyl-13,16-dimethyl-9,9-dioxo-19-oxa-9λ6-thia-1,8,13,16-tetrazapentacyclo[15.9.1.12,6.13,26.020,25]nonacosa-2,4,6(29),20,22,24,26(28)-heptaen-7-one.
| Compound Name | (17R)-28-heptyl-13,16-dimethyl-9,9-dioxo-19-oxa-9λ6-thia-1,8,13,16-tetrazapentacyclo[15.9.1.12,6.13,26.020,25]nonacosa-2,4,6(29),20,22,24,26(28)-heptaen-7-one |
|---|---|
| PubChem CID | 71082130 |
| Molecular Formula | C32H44N4O4S |
| Molecular Weight | 580.80 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | (17R)-28-heptyl-13,16-dimethyl-9,9-dioxo-19-oxa-9λ6-thia-1,8,13,16-tetrazapentacyclo[15.9.1.12,6.13,26.020,25]nonacosa-2,4,6(29),20,22,24,26(28)-heptaen-7-one |
| SMILES | CCCCCCCc1c2n3c4cc(ccc14)C(=O)NS(=O)(=O)CCCN(C)CCN(C)[C@@H](COc1ccccc1-2)C3 |
| InChI | InChI=1S/C32H44N4O4S/c1-4-5-6-7-8-12-27-26-16-15-24-21-29(26)36-22-25(23-40-30-14-10-9-13-28(30)31(27)36)35(3)19-18-34(2)17-11-20-41(38,39)33-32(24)37/h9-10,13-16,21,25H,4-8,11-12,17-20,22-23H2,1-3H3,(H,33,37)/t25-/m1/s1 |
| InChIKey | QKPXPFRUSFHPSI-RUZDIDTESA-N |
| XLogP | 4.91 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.80 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|