About 6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one
6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one (PubChem CID 71082388) has the molecular formula C15H13NO
and a molecular weight of 223.28 g/mol. Its IUPAC name is 6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one.
Molecular Properties
| Compound Name | 6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one |
| PubChem CID | 71082388 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one |
| SMILES | CC1CC2=CC(=O)C=CC2=Nc2ccccc21 |
| InChI | InChI=1S/C15H13NO/c1-10-8-11-9-12(17)6-7-14(11)16-15-5-3-2-4-13(10)15/h2-7,9-10H,8H2,1H3 |
| InChIKey | PXWRPJVFUCMSPC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one?
The IUPAC name of 6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one (CID 71082388) is 6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one.
What is the SMILES notation for 6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one?
The canonical SMILES for 6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one is CC1CC2=CC(=O)C=CC2=Nc2ccccc21.
What is the InChIKey of 6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one?
The InChIKey is PXWRPJVFUCMSPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO/c1-10-8-11-9-12(17)6-7-14(11)16-15-5-3-2-4-13(10)15/h2-7,9-10H,8H2,1H3.
What are the key properties of 6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one?
6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one has a molecular weight of 223.28 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5,6-dihydrobenzo[b][1]benzazepin-3-one is sourced from PubChem (CID 71082388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).