About cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one
cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one (PubChem CID 71082391) has the molecular formula C12H24O3Si
and a molecular weight of 244.41 g/mol. Its IUPAC name is cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one.
Molecular Properties
| Compound Name | cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one |
| PubChem CID | 71082391 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one |
| SMILES | CC(C)(C[C@H]1CC(=O)C[C@@H](O)C1)[Si](C)(C)O |
| InChI | InChI=1S/C12H24O3Si/c1-12(2,16(3,4)15)8-9-5-10(13)7-11(14)6-9/h9-10,13,15H,5-8H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | WQJRWRMTYQONGM-ZJUUUORDSA-N |
| XLogP | 2.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one?
The IUPAC name of cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one (CID 71082391) is cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one.
What is the SMILES notation for cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one?
The canonical SMILES for cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one is CC(C)(C[C@H]1CC(=O)C[C@@H](O)C1)[Si](C)(C)O.
What is the InChIKey of cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one?
The InChIKey is WQJRWRMTYQONGM-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H24O3Si/c1-12(2,16(3,4)15)8-9-5-10(13)7-11(14)6-9/h9-10,13,15H,5-8H2,1-4H3/t9-,10+/m1/s1.
What are the key properties of cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one?
cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one has a molecular weight of 244.41 g/mol, XLogP of 2.08, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(3S,5R)-3-hydroxy-5-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]cyclohexan-1-one is sourced from PubChem (CID 71082391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).