About 3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine
3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine (PubChem CID 7108247) has the molecular formula C22H22N3O+
and a molecular weight of 344.44 g/mol. Its IUPAC name is 3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine.
Molecular Properties
| Compound Name | 3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine |
| PubChem CID | 7108247 |
| Molecular Formula | C22H22N3O+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine |
| SMILES | CC(C)C[n+]1cnc2oc(-c3ccccc3)c(-c3ccccc3)c2c1N |
| InChI | InChI=1S/C22H21N3O/c1-15(2)13-25-14-24-22-19(21(25)23)18(16-9-5-3-6-10-16)20(26-22)17-11-7-4-8-12-17/h3-12,14-15,23H,13H2,1-2H3/p+1 |
| InChIKey | XDPRDOSWJRRMRX-UHFFFAOYSA-O |
| XLogP | 4.69 |
| TPSA | 55.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine?
The IUPAC name of 3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine (CID 7108247) is 3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine.
What is the SMILES notation for 3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine?
The canonical SMILES for 3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine is CC(C)C[n+]1cnc2oc(-c3ccccc3)c(-c3ccccc3)c2c1N.
What is the InChIKey of 3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine?
The InChIKey is XDPRDOSWJRRMRX-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H21N3O/c1-15(2)13-25-14-24-22-19(21(25)23)18(16-9-5-3-6-10-16)20(26-22)17-11-7-4-8-12-17/h3-12,14-15,23H,13H2,1-2H3/p+1.
What are the key properties of 3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine?
3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine has a molecular weight of 344.44 g/mol, XLogP of 4.69, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylpropyl)-5,6-diphenylfuro[2,3-d]pyrimidin-3-ium-4-amine is sourced from PubChem (CID 7108247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).