C19H19NO9 — CID 71082621
methyl (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate;phenoxazin-3-one (PubChem CID 71082621) has the molecular formula C19H19NO9 and a molecular weight of 405.36 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate;phenoxazin-3-one.
| Compound Name | methyl (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate;phenoxazin-3-one |
|---|---|
| PubChem CID | 71082621 |
| Molecular Formula | C19H19NO9 |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate;phenoxazin-3-one |
| SMILES | COC(=O)[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O.O=c1ccc2nc3ccccc3oc-2c1 |
| InChI | InChI=1S/C12H7NO2.C7H12O7/c14-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)13-10;1-13-7(12)5-3(9)2(8)4(10)6(11)14-5/h1-7H;2-6,8-11H,1H3/t;2-,3-,4+,5-,6+/m.0/s1 |
| InChIKey | IIVDLQISMOZFPP-PVIAVJFXSA-N |
| XLogP | -0.75 |
| TPSA | 159.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|