About CID 71082782
CID 71082782 (PubChem CID 71082782) has the molecular formula C50H65Si
and a molecular weight of 694.16 g/mol.
Molecular Properties
| Compound Name | CID 71082782 |
| PubChem CID | 71082782 |
| Molecular Formula | C50H65Si |
| Molecular Weight | 694.16 g/mol |
| Exact Mass | 693.49 |
| IUPAC Name | — |
| SMILES | CC1=Cc2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cccc2C1[Si](C)C.CC1=Cc2c(cccc2-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)C1 |
| InChI | InChI=1S/C26H35Si.C24H30/c1-17-13-23-21(11-10-12-22(23)24(17)27(8)9)18-14-19(25(2,3)4)16-20(15-18)26(5,6)7;1-16-11-17-9-8-10-21(22(17)12-16)18-13-19(23(2,3)4)15-20(14-18)24(5,6)7/h10-16,24H,1-9H3;8-10,12-15H,11H2,1-7H3 |
| InChIKey | KPSAZSVXJZQUQA-UHFFFAOYSA-N |
| XLogP | 14.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 694.16 |
| LogP ≤ 5 | 14.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 71082782 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71082782?
The IUPAC name of CID 71082782 (CID 71082782) is not available.
What is the SMILES notation for CID 71082782?
The canonical SMILES for CID 71082782 is CC1=Cc2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cccc2C1[Si](C)C.CC1=Cc2c(cccc2-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)C1.
What is the InChIKey of CID 71082782?
The InChIKey is KPSAZSVXJZQUQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35Si.C24H30/c1-17-13-23-21(11-10-12-22(23)24(17)27(8)9)18-14-19(25(2,3)4)16-20(15-18)26(5,6)7;1-16-11-17-9-8-10-21(22(17)12-16)18-13-19(23(2,3)4)15-20(14-18)24(5,6)7/h10-16,24H,1-9H3;8-10,12-15H,11H2,1-7H3.
What are the key properties of CID 71082782?
CID 71082782 has a molecular weight of 694.16 g/mol, XLogP of 14.65, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71082782 is sourced from PubChem (CID 71082782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).