About [5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate
[5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate (PubChem CID 71082905) has the molecular formula C18H18N4O3S
and a molecular weight of 370.43 g/mol. Its IUPAC name is [5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate.
Molecular Properties
| Compound Name | [5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate |
| PubChem CID | 71082905 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate |
| SMILES | CCc1cc(-c2cncc(OC(=O)NCc3nccs3)c2)c(C)[nH]c1=O |
| InChI | InChI=1S/C18H18N4O3S/c1-3-12-7-15(11(2)22-17(12)23)13-6-14(9-19-8-13)25-18(24)21-10-16-20-4-5-26-16/h4-9H,3,10H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | WNRQJEGUDANUQF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate?
The IUPAC name of [5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate (CID 71082905) is [5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate.
What is the SMILES notation for [5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate?
The canonical SMILES for [5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate is CCc1cc(-c2cncc(OC(=O)NCc3nccs3)c2)c(C)[nH]c1=O.
What is the InChIKey of [5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate?
The InChIKey is WNRQJEGUDANUQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O3S/c1-3-12-7-15(11(2)22-17(12)23)13-6-14(9-19-8-13)25-18(24)21-10-16-20-4-5-26-16/h4-9H,3,10H2,1-2H3,(H,21,24)(H,22,23).
What are the key properties of [5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate?
[5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate has a molecular weight of 370.43 g/mol, XLogP of 3.05, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-3-pyridinyl] N-(1,3-thiazol-2-ylmethyl)carbamate is sourced from PubChem (CID 71082905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).