C15H24N2 — CID 71083178
5-[(4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazole (PubChem CID 71083178) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 5-[(4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 5-[(4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 71083178 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 5-[(4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl)methyl]-4,5-dihydro-1H-imidazole |
| SMILES | CC12CCCCC1=CC(CC1CN=CN1)CC2 |
| InChI | InChI=1S/C15H24N2/c1-15-6-3-2-4-13(15)8-12(5-7-15)9-14-10-16-11-17-14/h8,11-12,14H,2-7,9-10H2,1H3,(H,16,17) |
| InChIKey | VXRLECOXWXOCKT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|