About 4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile
4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile (PubChem CID 71084896) has the molecular formula C13H8IN5S
and a molecular weight of 393.21 g/mol. Its IUPAC name is 4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile |
| PubChem CID | 71084896 |
| Molecular Formula | C13H8IN5S |
| Molecular Weight | 393.21 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | 4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile |
| SMILES | CSc1ncc(C#N)c(-c2c[nH]c3ncc(I)cc23)n1 |
| InChI | InChI=1S/C13H8IN5S/c1-20-13-18-4-7(3-15)11(19-13)10-6-17-12-9(10)2-8(14)5-16-12/h2,4-6H,1H3,(H,16,17) |
| InChIKey | RKTURCJODWJLGE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile?
The IUPAC name of 4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile (CID 71084896) is 4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile.
What is the SMILES notation for 4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile?
The canonical SMILES for 4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile is CSc1ncc(C#N)c(-c2c[nH]c3ncc(I)cc23)n1.
What is the InChIKey of 4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile?
The InChIKey is RKTURCJODWJLGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8IN5S/c1-20-13-18-4-7(3-15)11(19-13)10-6-17-12-9(10)2-8(14)5-16-12/h2,4-6H,1H3,(H,16,17).
What are the key properties of 4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile?
4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile has a molecular weight of 393.21 g/mol, XLogP of 3.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-iodo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-methylsulfanylpyrimidine-5-carbonitrile is sourced from PubChem (CID 71084896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).