C13H23N3 — CID 71085397
(9R)-N-ethyl-N,9-dimethyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-d]azepin-2-amine (PubChem CID 71085397) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is (9R)-N-ethyl-N,9-dimethyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-d]azepin-2-amine.
| Compound Name | (9R)-N-ethyl-N,9-dimethyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-d]azepin-2-amine |
|---|---|
| PubChem CID | 71085397 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | (9R)-N-ethyl-N,9-dimethyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-d]azepin-2-amine |
| SMILES | CCN(C)C1=NC2=C(CCNC[C@H]2C)CC1 |
| InChI | InChI=1S/C13H23N3/c1-4-16(3)12-6-5-11-7-8-14-9-10(2)13(11)15-12/h10,14H,4-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | MLXURMXOYGENQC-SNVBAGLBSA-N |
| XLogP | 2.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |