C21H26F3N5OS — CID 71085457
(2S)-2-amino-2-[5-[4-(1-hexylpyrazol-4-yl)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol (PubChem CID 71085457) has the molecular formula C21H26F3N5OS and a molecular weight of 453.53 g/mol. Its IUPAC name is (2S)-2-amino-2-[5-[4-(1-hexylpyrazol-4-yl)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol.
| Compound Name | (2S)-2-amino-2-[5-[4-(1-hexylpyrazol-4-yl)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 71085457 |
| Molecular Formula | C21H26F3N5OS |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | (2S)-2-amino-2-[5-[4-(1-hexylpyrazol-4-yl)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
| SMILES | CCCCCCn1cc(-c2ccc(-c3nnc([C@@](C)(N)CO)s3)cc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C21H26F3N5OS/c1-3-4-5-6-9-29-12-15(11-26-29)16-8-7-14(10-17(16)21(22,23)24)18-27-28-19(31-18)20(2,25)13-30/h7-8,10-12,30H,3-6,9,13,25H2,1-2H3/t20-/m0/s1 |
| InChIKey | VUFZZQJOXPRIQZ-FQEVSTJZSA-N |
| XLogP | 4.83 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|