About (4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate
(4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate (PubChem CID 71085490) has the molecular formula C11H16O5
and a molecular weight of 228.24 g/mol. Its IUPAC name is (4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate.
Molecular Properties
| Compound Name | (4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate |
| PubChem CID | 71085490 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate |
| SMILES | CC(=O)OCC1C(C)OC=CC1OC(C)=O |
| InChI | InChI=1S/C11H16O5/c1-7-10(6-15-8(2)12)11(4-5-14-7)16-9(3)13/h4-5,7,10-11H,6H2,1-3H3 |
| InChIKey | DALBLECTVWXIAK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate?
The IUPAC name of (4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate (CID 71085490) is (4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate.
What is the SMILES notation for (4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate?
The canonical SMILES for (4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate is CC(=O)OCC1C(C)OC=CC1OC(C)=O.
What is the InChIKey of (4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate?
The InChIKey is DALBLECTVWXIAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O5/c1-7-10(6-15-8(2)12)11(4-5-14-7)16-9(3)13/h4-5,7,10-11H,6H2,1-3H3.
What are the key properties of (4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate?
(4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate has a molecular weight of 228.24 g/mol, XLogP of 1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl)methyl acetate is sourced from PubChem (CID 71085490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).