C25H26N2O — CID 71085951
[(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-isoquinolin-1-ylmethanone (PubChem CID 71085951) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-isoquinolin-1-ylmethanone.
| Compound Name | [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-isoquinolin-1-ylmethanone |
|---|---|
| PubChem CID | 71085951 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-isoquinolin-1-ylmethanone |
| SMILES | O=C(c1nccc2ccccc12)N1CC[C@H](c2ccccc2)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C25H26N2O/c28-25(24-21-11-5-4-10-19(21)14-16-26-24)27-17-15-20(18-8-2-1-3-9-18)22-12-6-7-13-23(22)27/h1-5,8-11,14,16,20,22-23H,6-7,12-13,15,17H2/t20-,22-,23-/m1/s1 |
| InChIKey | INWJSPYMFKUYGR-YMPZKCBVSA-N |
| XLogP | 5.42 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |