C19H24N4O — CID 71085989
[(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-methyl-1H-1,2,4-triazol-3-yl)methanone (PubChem CID 71085989) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-methyl-1H-1,2,4-triazol-3-yl)methanone.
| Compound Name | [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-methyl-1H-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 71085989 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-methyl-1H-1,2,4-triazol-3-yl)methanone |
| SMILES | Cc1nc(C(=O)N2CC[C@H](c3ccccc3)[C@H]3CCCC[C@H]32)n[nH]1 |
| InChI | InChI=1S/C19H24N4O/c1-13-20-18(22-21-13)19(24)23-12-11-15(14-7-3-2-4-8-14)16-9-5-6-10-17(16)23/h2-4,7-8,15-17H,5-6,9-12H2,1H3,(H,20,21,22)/t15-,16-,17-/m1/s1 |
| InChIKey | UMAMQYAGJGBFBV-BRWVUGGUSA-N |
| XLogP | 3.30 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |