C14H22N2 — CID 71086605
1-N,4-N-dibutylcyclohexa-2,5-diene-1,4-diimine (PubChem CID 71086605) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-N,4-N-dibutylcyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 1-N,4-N-dibutylcyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 71086605 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-N,4-N-dibutylcyclohexa-2,5-diene-1,4-diimine |
| SMILES | CCCCN=C1C=CC(=NCCCC)C=C1 |
| InChI | InChI=1S/C14H22N2/c1-3-5-11-15-13-7-9-14(10-8-13)16-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3/b15-13-,16-14+ |
| InChIKey | FDUBCILVQDRDJR-VCFJNTAESA-N |
| XLogP | 3.59 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|