C19H36O9 — CID 71086923
[2-hydroxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] decanoate (PubChem CID 71086923) has the molecular formula C19H36O9 and a molecular weight of 408.49 g/mol. Its IUPAC name is [2-hydroxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] decanoate.
| Compound Name | [2-hydroxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] decanoate |
|---|---|
| PubChem CID | 71086923 |
| Molecular Formula | C19H36O9 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [2-hydroxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(O)CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H36O9/c1-2-3-4-5-6-7-8-9-15(22)26-11-13(21)12-27-19-18(25)17(24)16(23)14(10-20)28-19/h13-14,16-21,23-25H,2-12H2,1H3/t13?,14-,16+,17+,18-,19-/m1/s1 |
| InChIKey | PQBISKBUTPCQQU-TVMOWAEESA-N |
| XLogP | -0.15 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|