C17H16F4N4O2 — CID 71086951
1-[2-fluoro-4-[(2S)-morpholin-2-yl]phenyl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea (PubChem CID 71086951) has the molecular formula C17H16F4N4O2 and a molecular weight of 384.33 g/mol. Its IUPAC name is 1-[2-fluoro-4-[(2S)-morpholin-2-yl]phenyl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea.
| Compound Name | 1-[2-fluoro-4-[(2S)-morpholin-2-yl]phenyl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 71086951 |
| Molecular Formula | C17H16F4N4O2 |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1-[2-fluoro-4-[(2S)-morpholin-2-yl]phenyl]-3-[6-(trifluoromethyl)-3-pyridinyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)nc1)Nc1ccc([C@H]2CNCCO2)cc1F |
| InChI | InChI=1S/C17H16F4N4O2/c18-12-7-10(14-9-22-5-6-27-14)1-3-13(12)25-16(26)24-11-2-4-15(23-8-11)17(19,20)21/h1-4,7-8,14,22H,5-6,9H2,(H2,24,25,26)/t14-/m1/s1 |
| InChIKey | MTXYCFXNJBJVPV-CQSZACIVSA-N |
| XLogP | 3.54 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |