C19H17ClF2N4O3 — CID 71087095
1-[2-chloro-4-[(2R)-morpholin-2-yl]phenyl]-3-[5-cyano-2-(difluoromethoxy)phenyl]urea (PubChem CID 71087095) has the molecular formula C19H17ClF2N4O3 and a molecular weight of 422.82 g/mol. Its IUPAC name is 1-[2-chloro-4-[(2R)-morpholin-2-yl]phenyl]-3-[5-cyano-2-(difluoromethoxy)phenyl]urea.
| Compound Name | 1-[2-chloro-4-[(2R)-morpholin-2-yl]phenyl]-3-[5-cyano-2-(difluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 71087095 |
| Molecular Formula | C19H17ClF2N4O3 |
| Molecular Weight | 422.82 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-[2-chloro-4-[(2R)-morpholin-2-yl]phenyl]-3-[5-cyano-2-(difluoromethoxy)phenyl]urea |
| SMILES | N#Cc1ccc(OC(F)F)c(NC(=O)Nc2ccc([C@@H]3CNCCO3)cc2Cl)c1 |
| InChI | InChI=1S/C19H17ClF2N4O3/c20-13-8-12(17-10-24-5-6-28-17)2-3-14(13)25-19(27)26-15-7-11(9-23)1-4-16(15)29-18(21)22/h1-4,7-8,17-18,24H,5-6,10H2,(H2,25,26,27)/t17-/m0/s1 |
| InChIKey | BZPDPMRSUULMIB-KRWDZBQOSA-N |
| XLogP | 4.12 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.82 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |