C18H17FN4O3 — CID 71087131
2-cyano-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]-6-methoxypyridine-4-carboxamide (PubChem CID 71087131) has the molecular formula C18H17FN4O3 and a molecular weight of 356.36 g/mol. Its IUPAC name is 2-cyano-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]-6-methoxypyridine-4-carboxamide.
| Compound Name | 2-cyano-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]-6-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 71087131 |
| Molecular Formula | C18H17FN4O3 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-cyano-N-[3-fluoro-4-[(2S)-morpholin-2-yl]phenyl]-6-methoxypyridine-4-carboxamide |
| SMILES | COc1cc(C(=O)Nc2ccc([C@H]3CNCCO3)c(F)c2)cc(C#N)n1 |
| InChI | InChI=1S/C18H17FN4O3/c1-25-17-7-11(6-13(9-20)22-17)18(24)23-12-2-3-14(15(19)8-12)16-10-21-4-5-26-16/h2-3,6-8,16,21H,4-5,10H2,1H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | LEUWDIMDYIZVJG-MRXNPFEDSA-N |
| XLogP | 2.01 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |