About methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate
methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate (PubChem CID 71087928) has the molecular formula C18H19Cl2N3O3
and a molecular weight of 396.27 g/mol. Its IUPAC name is methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate.
Molecular Properties
| Compound Name | methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate |
| PubChem CID | 71087928 |
| Molecular Formula | C18H19Cl2N3O3 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)c1ccc(C)c(Nc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C18H19Cl2N3O3/c1-10-5-7-14(16(24)23-18(2,3)17(25)26-4)22-15(10)21-13-8-6-11(19)9-12(13)20/h5-9H,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | SJHNRQFOHFFIFU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate?
The IUPAC name of methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate (CID 71087928) is methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate.
What is the SMILES notation for methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate?
The canonical SMILES for methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate is COC(=O)C(C)(C)NC(=O)c1ccc(C)c(Nc2ccc(Cl)cc2Cl)n1.
What is the InChIKey of methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate?
The InChIKey is SJHNRQFOHFFIFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19Cl2N3O3/c1-10-5-7-14(16(24)23-18(2,3)17(25)26-4)22-15(10)21-13-8-6-11(19)9-12(13)20/h5-9H,1-4H3,(H,21,22)(H,23,24).
What are the key properties of methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate?
methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate has a molecular weight of 396.27 g/mol, XLogP of 4.12, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[6-(2,4-dichloroanilino)-5-methylpyridine-2-carbonyl]amino]-2-methylpropanoate is sourced from PubChem (CID 71087928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).